About 2-(2,6-dichlorophenyl)cycloheptane-1-carbonitrile
2-(2,6-dichlorophenyl)cycloheptane-1-carbonitrile (PubChem CID 82247164) has the molecular formula C14H15Cl2N
and a molecular weight of 268.19 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)cycloheptane-1-carbonitrile.
Molecular Properties
| Compound Name | 2-(2,6-dichlorophenyl)cycloheptane-1-carbonitrile |
| PubChem CID | 82247164 |
| Molecular Formula | C14H15Cl2N |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-(2,6-dichlorophenyl)cycloheptane-1-carbonitrile |
| SMILES | N#CC1CCCCCC1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H15Cl2N/c15-12-7-4-8-13(16)14(12)11-6-3-1-2-5-10(11)9-17/h4,7-8,10-11H,1-3,5-6H2 |
| InChIKey | KMGIMZYWQKDMCQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,6-dichlorophenyl)cycloheptane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dichlorophenyl)cycloheptane-1-carbonitrile?
The IUPAC name of 2-(2,6-dichlorophenyl)cycloheptane-1-carbonitrile (CID 82247164) is 2-(2,6-dichlorophenyl)cycloheptane-1-carbonitrile.
What is the SMILES notation for 2-(2,6-dichlorophenyl)cycloheptane-1-carbonitrile?
The canonical SMILES for 2-(2,6-dichlorophenyl)cycloheptane-1-carbonitrile is N#CC1CCCCCC1c1c(Cl)cccc1Cl.
What is the InChIKey of 2-(2,6-dichlorophenyl)cycloheptane-1-carbonitrile?
The InChIKey is KMGIMZYWQKDMCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl2N/c15-12-7-4-8-13(16)14(12)11-6-3-1-2-5-10(11)9-17/h4,7-8,10-11H,1-3,5-6H2.
What are the key properties of 2-(2,6-dichlorophenyl)cycloheptane-1-carbonitrile?
2-(2,6-dichlorophenyl)cycloheptane-1-carbonitrile has a molecular weight of 268.19 g/mol, XLogP of 5.18, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dichlorophenyl)cycloheptane-1-carbonitrile is sourced from PubChem (CID 82247164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).