C15H12N2OS — CID 82247206
9-oxa-5-thia-3-azatetracyclo[8.8.0.02,6.011,16]octadeca-1(10),2(6),3,11,13,15,17-heptaen-4-amine (PubChem CID 82247206) has the molecular formula C15H12N2OS and a molecular weight of 268.34 g/mol. Its IUPAC name is 9-oxa-5-thia-3-azatetracyclo[8.8.0.02,6.011,16]octadeca-1(10),2(6),3,11,13,15,17-heptaen-4-amine.
| Compound Name | 9-oxa-5-thia-3-azatetracyclo[8.8.0.02,6.011,16]octadeca-1(10),2(6),3,11,13,15,17-heptaen-4-amine |
|---|---|
| PubChem CID | 82247206 |
| Molecular Formula | C15H12N2OS |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 9-oxa-5-thia-3-azatetracyclo[8.8.0.02,6.011,16]octadeca-1(10),2(6),3,11,13,15,17-heptaen-4-amine |
| SMILES | Nc1nc2c(s1)CCOc1c-2ccc2ccccc12 |
| InChI | InChI=1S/C15H12N2OS/c16-15-17-13-11-6-5-9-3-1-2-4-10(9)14(11)18-8-7-12(13)19-15/h1-6H,7-8H2,(H2,16,17) |
| InChIKey | OTXJHFIAWYTMNL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |