About cyclohexyl-[5,5-dimethyl-2-(2-methylpropyl)piperazin-1-yl]methanone
cyclohexyl-[5,5-dimethyl-2-(2-methylpropyl)piperazin-1-yl]methanone (PubChem CID 82249108) has the molecular formula C17H32N2O
and a molecular weight of 280.46 g/mol. Its IUPAC name is cyclohexyl-[5,5-dimethyl-2-(2-methylpropyl)piperazin-1-yl]methanone.
Molecular Properties
| Compound Name | cyclohexyl-[5,5-dimethyl-2-(2-methylpropyl)piperazin-1-yl]methanone |
| PubChem CID | 82249108 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | cyclohexyl-[5,5-dimethyl-2-(2-methylpropyl)piperazin-1-yl]methanone |
| SMILES | CC(C)CC1CNC(C)(C)CN1C(=O)C1CCCCC1 |
| InChI | InChI=1S/C17H32N2O/c1-13(2)10-15-11-18-17(3,4)12-19(15)16(20)14-8-6-5-7-9-14/h13-15,18H,5-12H2,1-4H3 |
| InChIKey | OOXKIGFXAJDKOX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexyl-[5,5-dimethyl-2-(2-methylpropyl)piperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-[5,5-dimethyl-2-(2-methylpropyl)piperazin-1-yl]methanone?
The IUPAC name of cyclohexyl-[5,5-dimethyl-2-(2-methylpropyl)piperazin-1-yl]methanone (CID 82249108) is cyclohexyl-[5,5-dimethyl-2-(2-methylpropyl)piperazin-1-yl]methanone.
What is the SMILES notation for cyclohexyl-[5,5-dimethyl-2-(2-methylpropyl)piperazin-1-yl]methanone?
The canonical SMILES for cyclohexyl-[5,5-dimethyl-2-(2-methylpropyl)piperazin-1-yl]methanone is CC(C)CC1CNC(C)(C)CN1C(=O)C1CCCCC1.
What is the InChIKey of cyclohexyl-[5,5-dimethyl-2-(2-methylpropyl)piperazin-1-yl]methanone?
The InChIKey is OOXKIGFXAJDKOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32N2O/c1-13(2)10-15-11-18-17(3,4)12-19(15)16(20)14-8-6-5-7-9-14/h13-15,18H,5-12H2,1-4H3.
What are the key properties of cyclohexyl-[5,5-dimethyl-2-(2-methylpropyl)piperazin-1-yl]methanone?
cyclohexyl-[5,5-dimethyl-2-(2-methylpropyl)piperazin-1-yl]methanone has a molecular weight of 280.46 g/mol, XLogP of 3.19, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-[5,5-dimethyl-2-(2-methylpropyl)piperazin-1-yl]methanone is sourced from PubChem (CID 82249108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).