About 3-[4-(dimethylamino)-6,7-dimethoxy-2-methylquinolin-3-yl]propanenitrile
3-[4-(dimethylamino)-6,7-dimethoxy-2-methylquinolin-3-yl]propanenitrile (PubChem CID 82252201) has the molecular formula C17H21N3O2
and a molecular weight of 299.37 g/mol. Its IUPAC name is 3-[4-(dimethylamino)-6,7-dimethoxy-2-methylquinolin-3-yl]propanenitrile.
Molecular Properties
| Compound Name | 3-[4-(dimethylamino)-6,7-dimethoxy-2-methylquinolin-3-yl]propanenitrile |
| PubChem CID | 82252201 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 3-[4-(dimethylamino)-6,7-dimethoxy-2-methylquinolin-3-yl]propanenitrile |
| SMILES | COc1cc2nc(C)c(CCC#N)c(N(C)C)c2cc1OC |
| InChI | InChI=1S/C17H21N3O2/c1-11-12(7-6-8-18)17(20(2)3)13-9-15(21-4)16(22-5)10-14(13)19-11/h9-10H,6-7H2,1-5H3 |
| InChIKey | LFQRVQMAEXVIPL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 58.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-(dimethylamino)-6,7-dimethoxy-2-methylquinolin-3-yl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(dimethylamino)-6,7-dimethoxy-2-methylquinolin-3-yl]propanenitrile?
The IUPAC name of 3-[4-(dimethylamino)-6,7-dimethoxy-2-methylquinolin-3-yl]propanenitrile (CID 82252201) is 3-[4-(dimethylamino)-6,7-dimethoxy-2-methylquinolin-3-yl]propanenitrile.
What is the SMILES notation for 3-[4-(dimethylamino)-6,7-dimethoxy-2-methylquinolin-3-yl]propanenitrile?
The canonical SMILES for 3-[4-(dimethylamino)-6,7-dimethoxy-2-methylquinolin-3-yl]propanenitrile is COc1cc2nc(C)c(CCC#N)c(N(C)C)c2cc1OC.
What is the InChIKey of 3-[4-(dimethylamino)-6,7-dimethoxy-2-methylquinolin-3-yl]propanenitrile?
The InChIKey is LFQRVQMAEXVIPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O2/c1-11-12(7-6-8-18)17(20(2)3)13-9-15(21-4)16(22-5)10-14(13)19-11/h9-10H,6-7H2,1-5H3.
What are the key properties of 3-[4-(dimethylamino)-6,7-dimethoxy-2-methylquinolin-3-yl]propanenitrile?
3-[4-(dimethylamino)-6,7-dimethoxy-2-methylquinolin-3-yl]propanenitrile has a molecular weight of 299.37 g/mol, XLogP of 3.08, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(dimethylamino)-6,7-dimethoxy-2-methylquinolin-3-yl]propanenitrile is sourced from PubChem (CID 82252201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).