About 3,4-diaminonaphthalene-1,2-diol
3,4-diaminonaphthalene-1,2-diol (PubChem CID 82254146) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is 3,4-diaminonaphthalene-1,2-diol.
Molecular Properties
| Compound Name | 3,4-diaminonaphthalene-1,2-diol |
| PubChem CID | 82254146 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 3,4-diaminonaphthalene-1,2-diol |
| SMILES | Nc1c(O)c(O)c2ccccc2c1N |
| InChI | InChI=1S/C10H10N2O2/c11-7-5-3-1-2-4-6(5)9(13)10(14)8(7)12/h1-4,13-14H,11-12H2 |
| InChIKey | JBYDXPNHIIFEDK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diaminonaphthalene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diaminonaphthalene-1,2-diol?
The IUPAC name of 3,4-diaminonaphthalene-1,2-diol (CID 82254146) is 3,4-diaminonaphthalene-1,2-diol.
What is the SMILES notation for 3,4-diaminonaphthalene-1,2-diol?
The canonical SMILES for 3,4-diaminonaphthalene-1,2-diol is Nc1c(O)c(O)c2ccccc2c1N.
What is the InChIKey of 3,4-diaminonaphthalene-1,2-diol?
The InChIKey is JBYDXPNHIIFEDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c11-7-5-3-1-2-4-6(5)9(13)10(14)8(7)12/h1-4,13-14H,11-12H2.
What are the key properties of 3,4-diaminonaphthalene-1,2-diol?
3,4-diaminonaphthalene-1,2-diol has a molecular weight of 190.20 g/mol, XLogP of 1.42, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diaminonaphthalene-1,2-diol is sourced from PubChem (CID 82254146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).