2,6-diethoxypyrimidine-4-carboxylic acid

C9H12N2O4 — CID 82254266

IUPAC2,6-diethoxypyrimidine-4-carboxylic acid
SMILESCCOc1cc(C(=O)O)nc(OCC)n1
InChIInChI=1S/C9H12N2O4/c1-3-14-7-5-6(8(12)13)10-9(11-7)15-4-2/h5H,3-4H2,1-2H3,(H,12,13)
InChIKeyHZIBWJBHOJGXIY-UHFFFAOYSA-N
MW212.20 g/mol
LogP0.97
Rot. Bonds5

About 2,6-diethoxypyrimidine-4-carboxylic acid

2,6-diethoxypyrimidine-4-carboxylic acid (PubChem CID 82254266) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is 2,6-diethoxypyrimidine-4-carboxylic acid.

Molecular Properties

Compound Name2,6-diethoxypyrimidine-4-carboxylic acid
PubChem CID82254266
Molecular FormulaC9H12N2O4
Molecular Weight212.20 g/mol
Exact Mass212.08
IUPAC Name2,6-diethoxypyrimidine-4-carboxylic acid
SMILESCCOc1cc(C(=O)O)nc(OCC)n1
InChIInChI=1S/C9H12N2O4/c1-3-14-7-5-6(8(12)13)10-9(11-7)15-4-2/h5H,3-4H2,1-2H3,(H,12,13)
InChIKeyHZIBWJBHOJGXIY-UHFFFAOYSA-N
XLogP0.97
TPSA81.54 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.20
LogP ≤ 50.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2,6-diethoxypyrimidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-diethoxypyrimidine-4-carboxylic acid?
The IUPAC name of 2,6-diethoxypyrimidine-4-carboxylic acid (CID 82254266) is 2,6-diethoxypyrimidine-4-carboxylic acid.
What is the SMILES notation for 2,6-diethoxypyrimidine-4-carboxylic acid?
The canonical SMILES for 2,6-diethoxypyrimidine-4-carboxylic acid is CCOc1cc(C(=O)O)nc(OCC)n1.
What is the InChIKey of 2,6-diethoxypyrimidine-4-carboxylic acid?
The InChIKey is HZIBWJBHOJGXIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4/c1-3-14-7-5-6(8(12)13)10-9(11-7)15-4-2/h5H,3-4H2,1-2H3,(H,12,13).
What are the key properties of 2,6-diethoxypyrimidine-4-carboxylic acid?
2,6-diethoxypyrimidine-4-carboxylic acid has a molecular weight of 212.20 g/mol, XLogP of 0.97, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diethoxypyrimidine-4-carboxylic acid is sourced from PubChem (CID 82254266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).