C12H9ClO5 — CID 82254523
5-chloro-4-hydroxy-7,8-dimethoxynaphthalene-1,2-dione (PubChem CID 82254523) has the molecular formula C12H9ClO5 and a molecular weight of 268.65 g/mol. Its IUPAC name is 5-chloro-4-hydroxy-7,8-dimethoxynaphthalene-1,2-dione.
| Compound Name | 5-chloro-4-hydroxy-7,8-dimethoxynaphthalene-1,2-dione |
|---|---|
| PubChem CID | 82254523 |
| Molecular Formula | C12H9ClO5 |
| Molecular Weight | 268.65 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 5-chloro-4-hydroxy-7,8-dimethoxynaphthalene-1,2-dione |
| SMILES | COc1cc(Cl)c2c(c1OC)C(=O)C(=O)C=C2O |
| InChI | InChI=1S/C12H9ClO5/c1-17-8-3-5(13)9-6(14)4-7(15)11(16)10(9)12(8)18-2/h3-4,14H,1-2H3 |
| InChIKey | QWVLXKPICPKNKP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.65 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|