C12H21Cl3N2O2 — CID 822563
2-methyl-N-[(1S)-2,2,2-trichloro-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]ethyl]propanamide (PubChem CID 822563) has the molecular formula C12H21Cl3N2O2 and a molecular weight of 331.67 g/mol. Its IUPAC name is 2-methyl-N-[(1S)-2,2,2-trichloro-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]ethyl]propanamide.
| Compound Name | 2-methyl-N-[(1S)-2,2,2-trichloro-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 822563 |
| Molecular Formula | C12H21Cl3N2O2 |
| Molecular Weight | 331.67 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-methyl-N-[(1S)-2,2,2-trichloro-1-[(2R,6R)-2,6-dimethylmorpholin-4-yl]ethyl]propanamide |
| SMILES | CC(C)C(=O)N[C@@H](N1C[C@@H](C)O[C@H](C)C1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H21Cl3N2O2/c1-7(2)10(18)16-11(12(13,14)15)17-5-8(3)19-9(4)6-17/h7-9,11H,5-6H2,1-4H3,(H,16,18)/t8-,9-,11+/m1/s1 |
| InChIKey | MSUUUUMWMGOARJ-KKZNHRDASA-N |
| XLogP | 2.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.67 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|