C11H19Cl3N2O2 — CID 822571
N-[(1S)-2,2,2-trichloro-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]propanamide (PubChem CID 822571) has the molecular formula C11H19Cl3N2O2 and a molecular weight of 317.64 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]propanamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 822571 |
| Molecular Formula | C11H19Cl3N2O2 |
| Molecular Weight | 317.64 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]ethyl]propanamide |
| SMILES | CCC(=O)N[C@@H](N1C[C@@H](C)O[C@@H](C)C1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H19Cl3N2O2/c1-4-9(17)15-10(11(12,13)14)16-5-7(2)18-8(3)6-16/h7-8,10H,4-6H2,1-3H3,(H,15,17)/t7-,8+,10-/m0/s1 |
| InChIKey | VJEWQZCTQBQROB-XKSSXDPKSA-N |
| XLogP | 2.32 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.64 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|