C14H24N2O — CID 82257317
3-[2-(3-propan-2-yloxypropylamino)ethyl]aniline (PubChem CID 82257317) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 3-[2-(3-propan-2-yloxypropylamino)ethyl]aniline.
| Compound Name | 3-[2-(3-propan-2-yloxypropylamino)ethyl]aniline |
|---|---|
| PubChem CID | 82257317 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 3-[2-(3-propan-2-yloxypropylamino)ethyl]aniline |
| SMILES | CC(C)OCCCNCCc1cccc(N)c1 |
| InChI | InChI=1S/C14H24N2O/c1-12(2)17-10-4-8-16-9-7-13-5-3-6-14(15)11-13/h3,5-6,11-12,16H,4,7-10,15H2,1-2H3 |
| InChIKey | XADOYYNJZAQIED-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|