C19H26BrNO2 — CID 82258967
1-[6-(2-bromo-2-methylpropanoyl)-3,4-dihydro-2H-quinolin-1-yl]-2-ethylbutan-1-one (PubChem CID 82258967) has the molecular formula C19H26BrNO2 and a molecular weight of 380.33 g/mol. Its IUPAC name is 1-[6-(2-bromo-2-methylpropanoyl)-3,4-dihydro-2H-quinolin-1-yl]-2-ethylbutan-1-one.
| Compound Name | 1-[6-(2-bromo-2-methylpropanoyl)-3,4-dihydro-2H-quinolin-1-yl]-2-ethylbutan-1-one |
|---|---|
| PubChem CID | 82258967 |
| Molecular Formula | C19H26BrNO2 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 1-[6-(2-bromo-2-methylpropanoyl)-3,4-dihydro-2H-quinolin-1-yl]-2-ethylbutan-1-one |
| SMILES | CCC(CC)C(=O)N1CCCc2cc(C(=O)C(C)(C)Br)ccc21 |
| InChI | InChI=1S/C19H26BrNO2/c1-5-13(6-2)18(23)21-11-7-8-14-12-15(9-10-16(14)21)17(22)19(3,4)20/h9-10,12-13H,5-8,11H2,1-4H3 |
| InChIKey | ICAPNGHDCURPPK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|