C19H30N2O — CID 82259825
1-[5-(2-aminohexyl)-2,3-dihydroindol-1-yl]-3-methylbutan-1-one (PubChem CID 82259825) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is 1-[5-(2-aminohexyl)-2,3-dihydroindol-1-yl]-3-methylbutan-1-one.
| Compound Name | 1-[5-(2-aminohexyl)-2,3-dihydroindol-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 82259825 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 1-[5-(2-aminohexyl)-2,3-dihydroindol-1-yl]-3-methylbutan-1-one |
| SMILES | CCCCC(N)Cc1ccc2c(c1)CCN2C(=O)CC(C)C |
| InChI | InChI=1S/C19H30N2O/c1-4-5-6-17(20)13-15-7-8-18-16(12-15)9-10-21(18)19(22)11-14(2)3/h7-8,12,14,17H,4-6,9-11,13,20H2,1-3H3 |
| InChIKey | GVADWPDEBOSEIM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |