C17H28N2O — CID 82259967
N-[4-(2-amino-4-methylpentyl)phenyl]-2,2-dimethylpropanamide (PubChem CID 82259967) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is N-[4-(2-amino-4-methylpentyl)phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-(2-amino-4-methylpentyl)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 82259967 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | N-[4-(2-amino-4-methylpentyl)phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)CC(N)Cc1ccc(NC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H28N2O/c1-12(2)10-14(18)11-13-6-8-15(9-7-13)19-16(20)17(3,4)5/h6-9,12,14H,10-11,18H2,1-5H3,(H,19,20) |
| InChIKey | CMJUXYDFMUPBKN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |