C18H31N3O — CID 82261405
N-[1-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)propan-2-yl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 82261405) has the molecular formula C18H31N3O and a molecular weight of 305.47 g/mol. Its IUPAC name is N-[1-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)propan-2-yl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[1-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)propan-2-yl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 82261405 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | N-[1-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)propan-2-yl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNC(C)Cc1ccc2c(c1)NCCO2 |
| InChI | InChI=1S/C18H31N3O/c1-4-21(5-2)11-6-9-19-15(3)13-16-7-8-18-17(14-16)20-10-12-22-18/h7-8,14-15,19-20H,4-6,9-13H2,1-3H3 |
| InChIKey | OORNSNWMVRVLJZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|