C20H34N2O2 — CID 82263878
1-(3-tert-butyl-4-ethoxyphenyl)-2-methyl-3-piperazin-1-ylpropan-1-ol (PubChem CID 82263878) has the molecular formula C20H34N2O2 and a molecular weight of 334.50 g/mol. Its IUPAC name is 1-(3-tert-butyl-4-ethoxyphenyl)-2-methyl-3-piperazin-1-ylpropan-1-ol.
| Compound Name | 1-(3-tert-butyl-4-ethoxyphenyl)-2-methyl-3-piperazin-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 82263878 |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | 1-(3-tert-butyl-4-ethoxyphenyl)-2-methyl-3-piperazin-1-ylpropan-1-ol |
| SMILES | CCOc1ccc(C(O)C(C)CN2CCNCC2)cc1C(C)(C)C |
| InChI | InChI=1S/C20H34N2O2/c1-6-24-18-8-7-16(13-17(18)20(3,4)5)19(23)15(2)14-22-11-9-21-10-12-22/h7-8,13,15,19,21,23H,6,9-12,14H2,1-5H3 |
| InChIKey | FIBRSJIUWDDWRL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |