C12H10Cl2N2O — CID 82268749
2,5-dichloro-1-(2-methoxyethyl)indole-3-carbonitrile (PubChem CID 82268749) has the molecular formula C12H10Cl2N2O and a molecular weight of 269.13 g/mol. Its IUPAC name is 2,5-dichloro-1-(2-methoxyethyl)indole-3-carbonitrile.
| Compound Name | 2,5-dichloro-1-(2-methoxyethyl)indole-3-carbonitrile |
|---|---|
| PubChem CID | 82268749 |
| Molecular Formula | C12H10Cl2N2O |
| Molecular Weight | 269.13 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 2,5-dichloro-1-(2-methoxyethyl)indole-3-carbonitrile |
| SMILES | COCCn1c(Cl)c(C#N)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C12H10Cl2N2O/c1-17-5-4-16-11-3-2-8(13)6-9(11)10(7-15)12(16)14/h2-3,6H,4-5H2,1H3 |
| InChIKey | XEWCZTNGTIZCEM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 37.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.13 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |