About 1-(2,5,7-trichloro-1H-indol-3-yl)ethanol
1-(2,5,7-trichloro-1H-indol-3-yl)ethanol (PubChem CID 82269510) has the molecular formula C10H8Cl3NO
and a molecular weight of 264.54 g/mol. Its IUPAC name is 1-(2,5,7-trichloro-1H-indol-3-yl)ethanol.
Molecular Properties
| Compound Name | 1-(2,5,7-trichloro-1H-indol-3-yl)ethanol |
| PubChem CID | 82269510 |
| Molecular Formula | C10H8Cl3NO |
| Molecular Weight | 264.54 g/mol |
| Exact Mass | 262.97 |
| IUPAC Name | 1-(2,5,7-trichloro-1H-indol-3-yl)ethanol |
| SMILES | CC(O)c1c(Cl)[nH]c2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C10H8Cl3NO/c1-4(15)8-6-2-5(11)3-7(12)9(6)14-10(8)13/h2-4,14-15H,1H3 |
| InChIKey | LWZDKSJLYQUTQS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2,5,7-trichloro-1H-indol-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5,7-trichloro-1H-indol-3-yl)ethanol?
The IUPAC name of 1-(2,5,7-trichloro-1H-indol-3-yl)ethanol (CID 82269510) is 1-(2,5,7-trichloro-1H-indol-3-yl)ethanol.
What is the SMILES notation for 1-(2,5,7-trichloro-1H-indol-3-yl)ethanol?
The canonical SMILES for 1-(2,5,7-trichloro-1H-indol-3-yl)ethanol is CC(O)c1c(Cl)[nH]c2c(Cl)cc(Cl)cc12.
What is the InChIKey of 1-(2,5,7-trichloro-1H-indol-3-yl)ethanol?
The InChIKey is LWZDKSJLYQUTQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Cl3NO/c1-4(15)8-6-2-5(11)3-7(12)9(6)14-10(8)13/h2-4,14-15H,1H3.
What are the key properties of 1-(2,5,7-trichloro-1H-indol-3-yl)ethanol?
1-(2,5,7-trichloro-1H-indol-3-yl)ethanol has a molecular weight of 264.54 g/mol, XLogP of 4.18, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5,7-trichloro-1H-indol-3-yl)ethanol is sourced from PubChem (CID 82269510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).