About 2-pentan-3-yl-5-propyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione
2-pentan-3-yl-5-propyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione (PubChem CID 82270114) has the molecular formula C14H21N3S
and a molecular weight of 263.41 g/mol. Its IUPAC name is 2-pentan-3-yl-5-propyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione.
Molecular Properties
| Compound Name | 2-pentan-3-yl-5-propyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione |
| PubChem CID | 82270114 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2-pentan-3-yl-5-propyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione |
| SMILES | CCCc1cc(=S)n2[nH]c(C(CC)CC)cc2n1 |
| InChI | InChI=1S/C14H21N3S/c1-4-7-11-8-14(18)17-13(15-11)9-12(16-17)10(5-2)6-3/h8-10,16H,4-7H2,1-3H3 |
| InChIKey | MINSYLGMIBODEV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-pentan-3-yl-5-propyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentan-3-yl-5-propyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione?
The IUPAC name of 2-pentan-3-yl-5-propyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione (CID 82270114) is 2-pentan-3-yl-5-propyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione.
What is the SMILES notation for 2-pentan-3-yl-5-propyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione?
The canonical SMILES for 2-pentan-3-yl-5-propyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione is CCCc1cc(=S)n2[nH]c(C(CC)CC)cc2n1.
What is the InChIKey of 2-pentan-3-yl-5-propyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione?
The InChIKey is MINSYLGMIBODEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3S/c1-4-7-11-8-14(18)17-13(15-11)9-12(16-17)10(5-2)6-3/h8-10,16H,4-7H2,1-3H3.
What are the key properties of 2-pentan-3-yl-5-propyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione?
2-pentan-3-yl-5-propyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione has a molecular weight of 263.41 g/mol, XLogP of 4.25, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentan-3-yl-5-propyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione is sourced from PubChem (CID 82270114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).