About 2,5-bis(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione
2,5-bis(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione (PubChem CID 82270142) has the molecular formula C8H3F6N3S
and a molecular weight of 287.19 g/mol. Its IUPAC name is 2,5-bis(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione.
Molecular Properties
| Compound Name | 2,5-bis(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione |
| PubChem CID | 82270142 |
| Molecular Formula | C8H3F6N3S |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 2,5-bis(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione |
| SMILES | FC(F)(F)c1cc(=S)n2[nH]c(C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C8H3F6N3S/c9-7(10,11)3-2-6(18)17-5(15-3)1-4(16-17)8(12,13)14/h1-2,16H |
| InChIKey | MJQQBHGEOZLWKF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione?
The IUPAC name of 2,5-bis(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione (CID 82270142) is 2,5-bis(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione.
What is the SMILES notation for 2,5-bis(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione?
The canonical SMILES for 2,5-bis(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione is FC(F)(F)c1cc(=S)n2[nH]c(C(F)(F)F)cc2n1.
What is the InChIKey of 2,5-bis(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione?
The InChIKey is MJQQBHGEOZLWKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3F6N3S/c9-7(10,11)3-2-6(18)17-5(15-3)1-4(16-17)8(12,13)14/h1-2,16H.
What are the key properties of 2,5-bis(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione?
2,5-bis(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione has a molecular weight of 287.19 g/mol, XLogP of 3.43, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-7-thione is sourced from PubChem (CID 82270142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).