C10H11N3S — CID 82270195
11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2-thione (PubChem CID 82270195) has the molecular formula C10H11N3S and a molecular weight of 205.29 g/mol. Its IUPAC name is 11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2-thione.
| Compound Name | 11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2-thione |
|---|---|
| PubChem CID | 82270195 |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2-thione |
| SMILES | Cc1cc2nc3c(c(=S)n2[nH]1)CCC3 |
| InChI | InChI=1S/C10H11N3S/c1-6-5-9-11-8-4-2-3-7(8)10(14)13(9)12-6/h5,12H,2-4H2,1H3 |
| InChIKey | KZYFFSLDTBIPHJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|