C14H17N3OS — CID 82270205
11-(oxan-4-yl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2-thione (PubChem CID 82270205) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is 11-(oxan-4-yl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2-thione.
| Compound Name | 11-(oxan-4-yl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2-thione |
|---|---|
| PubChem CID | 82270205 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 11-(oxan-4-yl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2-thione |
| SMILES | S=c1c2c(nc3cc(C4CCOCC4)[nH]n13)CCC2 |
| InChI | InChI=1S/C14H17N3OS/c19-14-10-2-1-3-11(10)15-13-8-12(16-17(13)14)9-4-6-18-7-5-9/h8-9,16H,1-7H2 |
| InChIKey | IIEYYBCGZFDAAH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|