C10H15N5O — CID 82270327
[5-ethyl-2-(methoxymethyl)pyrazolo[1,5-a]pyrimidin-7-yl]hydrazine (PubChem CID 82270327) has the molecular formula C10H15N5O and a molecular weight of 221.26 g/mol. Its IUPAC name is [5-ethyl-2-(methoxymethyl)pyrazolo[1,5-a]pyrimidin-7-yl]hydrazine.
| Compound Name | [5-ethyl-2-(methoxymethyl)pyrazolo[1,5-a]pyrimidin-7-yl]hydrazine |
|---|---|
| PubChem CID | 82270327 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | [5-ethyl-2-(methoxymethyl)pyrazolo[1,5-a]pyrimidin-7-yl]hydrazine |
| SMILES | CCc1cc(NN)n2nc(COC)cc2n1 |
| InChI | InChI=1S/C10H15N5O/c1-3-7-4-10(13-11)15-9(12-7)5-8(14-15)6-16-2/h4-5,13H,3,6,11H2,1-2H3 |
| InChIKey | HGPXEDCLRWWHGI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 77.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|