About 6-(2-aminoethyl)-2-(methoxymethyl)-5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one
6-(2-aminoethyl)-2-(methoxymethyl)-5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 82271814) has the molecular formula C11H16N4O2
and a molecular weight of 236.27 g/mol. Its IUPAC name is 6-(2-aminoethyl)-2-(methoxymethyl)-5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 6-(2-aminoethyl)-2-(methoxymethyl)-5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 82271814 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 6-(2-aminoethyl)-2-(methoxymethyl)-5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | COCc1cc2nc(C)c(CCN)c(=O)n2[nH]1 |
| InChI | InChI=1S/C11H16N4O2/c1-7-9(3-4-12)11(16)15-10(13-7)5-8(14-15)6-17-2/h5,14H,3-4,6,12H2,1-2H3 |
| InChIKey | GZXTVSALHUIPTG-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(2-aminoethyl)-2-(methoxymethyl)-5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-aminoethyl)-2-(methoxymethyl)-5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 6-(2-aminoethyl)-2-(methoxymethyl)-5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 82271814) is 6-(2-aminoethyl)-2-(methoxymethyl)-5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 6-(2-aminoethyl)-2-(methoxymethyl)-5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 6-(2-aminoethyl)-2-(methoxymethyl)-5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one is COCc1cc2nc(C)c(CCN)c(=O)n2[nH]1.
What is the InChIKey of 6-(2-aminoethyl)-2-(methoxymethyl)-5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is GZXTVSALHUIPTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O2/c1-7-9(3-4-12)11(16)15-10(13-7)5-8(14-15)6-17-2/h5,14H,3-4,6,12H2,1-2H3.
What are the key properties of 6-(2-aminoethyl)-2-(methoxymethyl)-5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
6-(2-aminoethyl)-2-(methoxymethyl)-5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 236.27 g/mol, XLogP of -0.02, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-aminoethyl)-2-(methoxymethyl)-5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 82271814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).