C12H13N3O2 — CID 82271842
2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidine-3-carbaldehyde (PubChem CID 82271842) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidine-3-carbaldehyde.
| Compound Name | 2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidine-3-carbaldehyde |
|---|---|
| PubChem CID | 82271842 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 2-(oxan-4-yl)pyrazolo[1,5-a]pyrimidine-3-carbaldehyde |
| SMILES | O=Cc1c(C2CCOCC2)nn2cccnc12 |
| InChI | InChI=1S/C12H13N3O2/c16-8-10-11(9-2-6-17-7-3-9)14-15-5-1-4-13-12(10)15/h1,4-5,8-9H,2-3,6-7H2 |
| InChIKey | KHJILBYPSVMPHH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|