About (2-propan-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)methanol
(2-propan-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)methanol (PubChem CID 82271913) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is (2-propan-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)methanol.
Molecular Properties
| Compound Name | (2-propan-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)methanol |
| PubChem CID | 82271913 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | (2-propan-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)methanol |
| SMILES | CC(C)c1nn2cccnc2c1CO |
| InChI | InChI=1S/C10H13N3O/c1-7(2)9-8(6-14)10-11-4-3-5-13(10)12-9/h3-5,7,14H,6H2,1-2H3 |
| InChIKey | OIDDTVUBHOAYDB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-propan-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-propan-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)methanol?
The IUPAC name of (2-propan-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)methanol (CID 82271913) is (2-propan-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)methanol.
What is the SMILES notation for (2-propan-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)methanol?
The canonical SMILES for (2-propan-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)methanol is CC(C)c1nn2cccnc2c1CO.
What is the InChIKey of (2-propan-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)methanol?
The InChIKey is OIDDTVUBHOAYDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-7(2)9-8(6-14)10-11-4-3-5-13(10)12-9/h3-5,7,14H,6H2,1-2H3.
What are the key properties of (2-propan-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)methanol?
(2-propan-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)methanol has a molecular weight of 191.23 g/mol, XLogP of 1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-propan-2-ylpyrazolo[1,5-a]pyrimidin-3-yl)methanol is sourced from PubChem (CID 82271913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).