About (2-cyclobutylpyrazolo[1,5-a]pyrimidin-3-yl)methanethiol
(2-cyclobutylpyrazolo[1,5-a]pyrimidin-3-yl)methanethiol (PubChem CID 82272076) has the molecular formula C11H13N3S
and a molecular weight of 219.31 g/mol. Its IUPAC name is (2-cyclobutylpyrazolo[1,5-a]pyrimidin-3-yl)methanethiol.
Molecular Properties
| Compound Name | (2-cyclobutylpyrazolo[1,5-a]pyrimidin-3-yl)methanethiol |
| PubChem CID | 82272076 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | (2-cyclobutylpyrazolo[1,5-a]pyrimidin-3-yl)methanethiol |
| SMILES | SCc1c(C2CCC2)nn2cccnc12 |
| InChI | InChI=1S/C11H13N3S/c15-7-9-10(8-3-1-4-8)13-14-6-2-5-12-11(9)14/h2,5-6,8,15H,1,3-4,7H2 |
| InChIKey | FROWOFXPKPMHAC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 30.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2-cyclobutylpyrazolo[1,5-a]pyrimidin-3-yl)methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclobutylpyrazolo[1,5-a]pyrimidin-3-yl)methanethiol?
The IUPAC name of (2-cyclobutylpyrazolo[1,5-a]pyrimidin-3-yl)methanethiol (CID 82272076) is (2-cyclobutylpyrazolo[1,5-a]pyrimidin-3-yl)methanethiol.
What is the SMILES notation for (2-cyclobutylpyrazolo[1,5-a]pyrimidin-3-yl)methanethiol?
The canonical SMILES for (2-cyclobutylpyrazolo[1,5-a]pyrimidin-3-yl)methanethiol is SCc1c(C2CCC2)nn2cccnc12.
What is the InChIKey of (2-cyclobutylpyrazolo[1,5-a]pyrimidin-3-yl)methanethiol?
The InChIKey is FROWOFXPKPMHAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3S/c15-7-9-10(8-3-1-4-8)13-14-6-2-5-12-11(9)14/h2,5-6,8,15H,1,3-4,7H2.
What are the key properties of (2-cyclobutylpyrazolo[1,5-a]pyrimidin-3-yl)methanethiol?
(2-cyclobutylpyrazolo[1,5-a]pyrimidin-3-yl)methanethiol has a molecular weight of 219.31 g/mol, XLogP of 2.43, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclobutylpyrazolo[1,5-a]pyrimidin-3-yl)methanethiol is sourced from PubChem (CID 82272076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).