C10H9NO — CID 82274917
1,1a,2,7b-tetrahydrocyclopropa[c]isoquinolin-3-one (PubChem CID 82274917) has the molecular formula C10H9NO and a molecular weight of 159.19 g/mol. Its IUPAC name is 1,1a,2,7b-tetrahydrocyclopropa[c]isoquinolin-3-one.
| Compound Name | 1,1a,2,7b-tetrahydrocyclopropa[c]isoquinolin-3-one |
|---|---|
| PubChem CID | 82274917 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 1,1a,2,7b-tetrahydrocyclopropa[c]isoquinolin-3-one |
| SMILES | O=C1NC2CC2c2ccccc21 |
| InChI | InChI=1S/C10H9NO/c12-10-7-4-2-1-3-6(7)8-5-9(8)11-10/h1-4,8-9H,5H2,(H,11,12) |
| InChIKey | PIECXUKJIJEKHJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |