C11H11BrN2S — CID 82275190
5-bromo-2-[(2-methyl-1,3-thiazol-5-yl)methyl]aniline (PubChem CID 82275190) has the molecular formula C11H11BrN2S and a molecular weight of 283.19 g/mol. Its IUPAC name is 5-bromo-2-[(2-methyl-1,3-thiazol-5-yl)methyl]aniline.
| Compound Name | 5-bromo-2-[(2-methyl-1,3-thiazol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 82275190 |
| Molecular Formula | C11H11BrN2S |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 5-bromo-2-[(2-methyl-1,3-thiazol-5-yl)methyl]aniline |
| SMILES | Cc1ncc(Cc2ccc(Br)cc2N)s1 |
| InChI | InChI=1S/C11H11BrN2S/c1-7-14-6-10(15-7)4-8-2-3-9(12)5-11(8)13/h2-3,5-6H,4,13H2,1H3 |
| InChIKey | RXNYTNAXKBRHLQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|