About 4-methoxy-1,2,3,4-tetrahydroquinoline
4-methoxy-1,2,3,4-tetrahydroquinoline (PubChem CID 82275496) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 4-methoxy-1,2,3,4-tetrahydroquinoline.
Molecular Properties
| Compound Name | 4-methoxy-1,2,3,4-tetrahydroquinoline |
| PubChem CID | 82275496 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 4-methoxy-1,2,3,4-tetrahydroquinoline |
| SMILES | COC1CCNc2ccccc21 |
| InChI | InChI=1S/C10H13NO/c1-12-10-6-7-11-9-5-3-2-4-8(9)10/h2-5,10-11H,6-7H2,1H3 |
| InChIKey | YELLUMXEKLYOOF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxy-1,2,3,4-tetrahydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1,2,3,4-tetrahydroquinoline?
The IUPAC name of 4-methoxy-1,2,3,4-tetrahydroquinoline (CID 82275496) is 4-methoxy-1,2,3,4-tetrahydroquinoline.
What is the SMILES notation for 4-methoxy-1,2,3,4-tetrahydroquinoline?
The canonical SMILES for 4-methoxy-1,2,3,4-tetrahydroquinoline is COC1CCNc2ccccc21.
What is the InChIKey of 4-methoxy-1,2,3,4-tetrahydroquinoline?
The InChIKey is YELLUMXEKLYOOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c1-12-10-6-7-11-9-5-3-2-4-8(9)10/h2-5,10-11H,6-7H2,1H3.
What are the key properties of 4-methoxy-1,2,3,4-tetrahydroquinoline?
4-methoxy-1,2,3,4-tetrahydroquinoline has a molecular weight of 163.22 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1,2,3,4-tetrahydroquinoline is sourced from PubChem (CID 82275496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).