C12H16N2O2 — CID 82276010
7-methyl-2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]quinolin-9-amine (PubChem CID 82276010) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 7-methyl-2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]quinolin-9-amine.
| Compound Name | 7-methyl-2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]quinolin-9-amine |
|---|---|
| PubChem CID | 82276010 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 7-methyl-2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]quinolin-9-amine |
| SMILES | CC1CC(N)c2cc3c(cc2N1)OCCO3 |
| InChI | InChI=1S/C12H16N2O2/c1-7-4-9(13)8-5-11-12(6-10(8)14-7)16-3-2-15-11/h5-7,9,14H,2-4,13H2,1H3 |
| InChIKey | VEPDZTBUTHCPSW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|