About (8-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methanamine
(8-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methanamine (PubChem CID 82276244) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is (8-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methanamine.
Analyze (8-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methanamine?
The IUPAC name of (8-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methanamine (CID 82276244) is (8-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methanamine.
What is the SMILES notation for (8-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methanamine?
The canonical SMILES for (8-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methanamine is Cc1cccc2c1NCCC2CN.
What is the InChIKey of (8-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methanamine?
The InChIKey is NWIJMJBTUHKTBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-8-3-2-4-10-9(7-12)5-6-13-11(8)10/h2-4,9,13H,5-7,12H2,1H3.
What are the key properties of (8-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methanamine?
(8-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methanamine has a molecular weight of 176.26 g/mol, XLogP of 1.85, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (8-methyl-1,2,3,4-tetrahydroquinolin-4-yl)methanamine is sourced from PubChem (CID 82276244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).