About 1,7-dimethyl-3,4-dihydro-2H-quinolin-4-amine
1,7-dimethyl-3,4-dihydro-2H-quinolin-4-amine (PubChem CID 82276289) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 1,7-dimethyl-3,4-dihydro-2H-quinolin-4-amine.
Molecular Properties
| Compound Name | 1,7-dimethyl-3,4-dihydro-2H-quinolin-4-amine |
| PubChem CID | 82276289 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1,7-dimethyl-3,4-dihydro-2H-quinolin-4-amine |
| SMILES | Cc1ccc2c(c1)N(C)CCC2N |
| InChI | InChI=1S/C11H16N2/c1-8-3-4-9-10(12)5-6-13(2)11(9)7-8/h3-4,7,10H,5-6,12H2,1-2H3 |
| InChIKey | YIVVOBZPZXJBHH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,7-dimethyl-3,4-dihydro-2H-quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dimethyl-3,4-dihydro-2H-quinolin-4-amine?
The IUPAC name of 1,7-dimethyl-3,4-dihydro-2H-quinolin-4-amine (CID 82276289) is 1,7-dimethyl-3,4-dihydro-2H-quinolin-4-amine.
What is the SMILES notation for 1,7-dimethyl-3,4-dihydro-2H-quinolin-4-amine?
The canonical SMILES for 1,7-dimethyl-3,4-dihydro-2H-quinolin-4-amine is Cc1ccc2c(c1)N(C)CCC2N.
What is the InChIKey of 1,7-dimethyl-3,4-dihydro-2H-quinolin-4-amine?
The InChIKey is YIVVOBZPZXJBHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-8-3-4-9-10(12)5-6-13(2)11(9)7-8/h3-4,7,10H,5-6,12H2,1-2H3.
What are the key properties of 1,7-dimethyl-3,4-dihydro-2H-quinolin-4-amine?
1,7-dimethyl-3,4-dihydro-2H-quinolin-4-amine has a molecular weight of 176.26 g/mol, XLogP of 1.83, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dimethyl-3,4-dihydro-2H-quinolin-4-amine is sourced from PubChem (CID 82276289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).