About 1-(4-aminophenyl)-5,5-dimethyl-1,3-diazinan-2-one
1-(4-aminophenyl)-5,5-dimethyl-1,3-diazinan-2-one (PubChem CID 82276547) has the molecular formula C12H17N3O
and a molecular weight of 219.29 g/mol. Its IUPAC name is 1-(4-aminophenyl)-5,5-dimethyl-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1-(4-aminophenyl)-5,5-dimethyl-1,3-diazinan-2-one |
| PubChem CID | 82276547 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 1-(4-aminophenyl)-5,5-dimethyl-1,3-diazinan-2-one |
| SMILES | CC1(C)CNC(=O)N(c2ccc(N)cc2)C1 |
| InChI | InChI=1S/C12H17N3O/c1-12(2)7-14-11(16)15(8-12)10-5-3-9(13)4-6-10/h3-6H,7-8,13H2,1-2H3,(H,14,16) |
| InChIKey | GEGCJMPJVMRTSZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-aminophenyl)-5,5-dimethyl-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-aminophenyl)-5,5-dimethyl-1,3-diazinan-2-one?
The IUPAC name of 1-(4-aminophenyl)-5,5-dimethyl-1,3-diazinan-2-one (CID 82276547) is 1-(4-aminophenyl)-5,5-dimethyl-1,3-diazinan-2-one.
What is the SMILES notation for 1-(4-aminophenyl)-5,5-dimethyl-1,3-diazinan-2-one?
The canonical SMILES for 1-(4-aminophenyl)-5,5-dimethyl-1,3-diazinan-2-one is CC1(C)CNC(=O)N(c2ccc(N)cc2)C1.
What is the InChIKey of 1-(4-aminophenyl)-5,5-dimethyl-1,3-diazinan-2-one?
The InChIKey is GEGCJMPJVMRTSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O/c1-12(2)7-14-11(16)15(8-12)10-5-3-9(13)4-6-10/h3-6H,7-8,13H2,1-2H3,(H,14,16).
What are the key properties of 1-(4-aminophenyl)-5,5-dimethyl-1,3-diazinan-2-one?
1-(4-aminophenyl)-5,5-dimethyl-1,3-diazinan-2-one has a molecular weight of 219.29 g/mol, XLogP of 1.82, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-aminophenyl)-5,5-dimethyl-1,3-diazinan-2-one is sourced from PubChem (CID 82276547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).