About (6-bromo-2,3-dihydro-1H-indol-3-yl)methanamine
(6-bromo-2,3-dihydro-1H-indol-3-yl)methanamine (PubChem CID 82276709) has the molecular formula C9H11BrN2
and a molecular weight of 227.10 g/mol. Its IUPAC name is (6-bromo-2,3-dihydro-1H-indol-3-yl)methanamine.
Molecular Properties
| Compound Name | (6-bromo-2,3-dihydro-1H-indol-3-yl)methanamine |
| PubChem CID | 82276709 |
| Molecular Formula | C9H11BrN2 |
| Molecular Weight | 227.10 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | (6-bromo-2,3-dihydro-1H-indol-3-yl)methanamine |
| SMILES | NCC1CNc2cc(Br)ccc21 |
| InChI | InChI=1S/C9H11BrN2/c10-7-1-2-8-6(4-11)5-12-9(8)3-7/h1-3,6,12H,4-5,11H2 |
| InChIKey | OIYPJEMYLPAHEX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.10 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6-bromo-2,3-dihydro-1H-indol-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-2,3-dihydro-1H-indol-3-yl)methanamine?
The IUPAC name of (6-bromo-2,3-dihydro-1H-indol-3-yl)methanamine (CID 82276709) is (6-bromo-2,3-dihydro-1H-indol-3-yl)methanamine.
What is the SMILES notation for (6-bromo-2,3-dihydro-1H-indol-3-yl)methanamine?
The canonical SMILES for (6-bromo-2,3-dihydro-1H-indol-3-yl)methanamine is NCC1CNc2cc(Br)ccc21.
What is the InChIKey of (6-bromo-2,3-dihydro-1H-indol-3-yl)methanamine?
The InChIKey is OIYPJEMYLPAHEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrN2/c10-7-1-2-8-6(4-11)5-12-9(8)3-7/h1-3,6,12H,4-5,11H2.
What are the key properties of (6-bromo-2,3-dihydro-1H-indol-3-yl)methanamine?
(6-bromo-2,3-dihydro-1H-indol-3-yl)methanamine has a molecular weight of 227.10 g/mol, XLogP of 1.92, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-2,3-dihydro-1H-indol-3-yl)methanamine is sourced from PubChem (CID 82276709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).