About 6-ethylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol
6-ethylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol (PubChem CID 82277028) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is 6-ethylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol.
Molecular Properties
| Compound Name | 6-ethylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol |
| PubChem CID | 82277028 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 6-ethylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol |
| SMILES | CCc1ccc2c(c1)C(O)CC21CCNCC1 |
| InChI | InChI=1S/C15H21NO/c1-2-11-3-4-13-12(9-11)14(17)10-15(13)5-7-16-8-6-15/h3-4,9,14,16-17H,2,5-8,10H2,1H3 |
| InChIKey | JTBZRQLUWGOBDC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol?
The IUPAC name of 6-ethylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol (CID 82277028) is 6-ethylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol.
What is the SMILES notation for 6-ethylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol?
The canonical SMILES for 6-ethylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol is CCc1ccc2c(c1)C(O)CC21CCNCC1.
What is the InChIKey of 6-ethylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol?
The InChIKey is JTBZRQLUWGOBDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO/c1-2-11-3-4-13-12(9-11)14(17)10-15(13)5-7-16-8-6-15/h3-4,9,14,16-17H,2,5-8,10H2,1H3.
What are the key properties of 6-ethylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol?
6-ethylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol has a molecular weight of 231.34 g/mol, XLogP of 2.31, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethylspiro[1,2-dihydroindene-3,4'-piperidine]-1-ol is sourced from PubChem (CID 82277028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).