About methyl N-[5-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]carbamate
methyl N-[5-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]carbamate (PubChem CID 822777) has the molecular formula C11H17N3O2S
and a molecular weight of 255.34 g/mol. Its IUPAC name is methyl N-[5-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]carbamate.
Molecular Properties
| Compound Name | methyl N-[5-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]carbamate |
| PubChem CID | 822777 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | methyl N-[5-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]carbamate |
| SMILES | COC(=O)Nc1ncc(CN2CCCCC2)s1 |
| InChI | InChI=1S/C11H17N3O2S/c1-16-11(15)13-10-12-7-9(17-10)8-14-5-3-2-4-6-14/h7H,2-6,8H2,1H3,(H,12,13,15) |
| InChIKey | FBZQVIZBDJOLEH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl N-[5-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[5-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]carbamate?
The IUPAC name of methyl N-[5-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]carbamate (CID 822777) is methyl N-[5-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]carbamate.
What is the SMILES notation for methyl N-[5-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]carbamate?
The canonical SMILES for methyl N-[5-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]carbamate is COC(=O)Nc1ncc(CN2CCCCC2)s1.
What is the InChIKey of methyl N-[5-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]carbamate?
The InChIKey is FBZQVIZBDJOLEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O2S/c1-16-11(15)13-10-12-7-9(17-10)8-14-5-3-2-4-6-14/h7H,2-6,8H2,1H3,(H,12,13,15).
What are the key properties of methyl N-[5-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]carbamate?
methyl N-[5-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]carbamate has a molecular weight of 255.34 g/mol, XLogP of 2.31, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[5-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]carbamate is sourced from PubChem (CID 822777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).