About 4-bromospiro[1,3-dihydroindene-2,1'-cyclopropane]-1-amine
4-bromospiro[1,3-dihydroindene-2,1'-cyclopropane]-1-amine (PubChem CID 82277978) has the molecular formula C11H12BrN
and a molecular weight of 238.13 g/mol. Its IUPAC name is 4-bromospiro[1,3-dihydroindene-2,1'-cyclopropane]-1-amine.
Molecular Properties
| Compound Name | 4-bromospiro[1,3-dihydroindene-2,1'-cyclopropane]-1-amine |
| PubChem CID | 82277978 |
| Molecular Formula | C11H12BrN |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 4-bromospiro[1,3-dihydroindene-2,1'-cyclopropane]-1-amine |
| SMILES | NC1c2cccc(Br)c2CC12CC2 |
| InChI | InChI=1S/C11H12BrN/c12-9-3-1-2-7-8(9)6-11(4-5-11)10(7)13/h1-3,10H,4-6,13H2 |
| InChIKey | QNNHEHDQMFFLML-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromospiro[1,3-dihydroindene-2,1'-cyclopropane]-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromospiro[1,3-dihydroindene-2,1'-cyclopropane]-1-amine?
The IUPAC name of 4-bromospiro[1,3-dihydroindene-2,1'-cyclopropane]-1-amine (CID 82277978) is 4-bromospiro[1,3-dihydroindene-2,1'-cyclopropane]-1-amine.
What is the SMILES notation for 4-bromospiro[1,3-dihydroindene-2,1'-cyclopropane]-1-amine?
The canonical SMILES for 4-bromospiro[1,3-dihydroindene-2,1'-cyclopropane]-1-amine is NC1c2cccc(Br)c2CC12CC2.
What is the InChIKey of 4-bromospiro[1,3-dihydroindene-2,1'-cyclopropane]-1-amine?
The InChIKey is QNNHEHDQMFFLML-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrN/c12-9-3-1-2-7-8(9)6-11(4-5-11)10(7)13/h1-3,10H,4-6,13H2.
What are the key properties of 4-bromospiro[1,3-dihydroindene-2,1'-cyclopropane]-1-amine?
4-bromospiro[1,3-dihydroindene-2,1'-cyclopropane]-1-amine has a molecular weight of 238.13 g/mol, XLogP of 2.79, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromospiro[1,3-dihydroindene-2,1'-cyclopropane]-1-amine is sourced from PubChem (CID 82277978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).