About 2-(2-piperazin-1-yl-1,3-thiazol-4-yl)ethanamine
2-(2-piperazin-1-yl-1,3-thiazol-4-yl)ethanamine (PubChem CID 82278115) has the molecular formula C9H16N4S
and a molecular weight of 212.32 g/mol. Its IUPAC name is 2-(2-piperazin-1-yl-1,3-thiazol-4-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(2-piperazin-1-yl-1,3-thiazol-4-yl)ethanamine |
| PubChem CID | 82278115 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 2-(2-piperazin-1-yl-1,3-thiazol-4-yl)ethanamine |
| SMILES | NCCc1csc(N2CCNCC2)n1 |
| InChI | InChI=1S/C9H16N4S/c10-2-1-8-7-14-9(12-8)13-5-3-11-4-6-13/h7,11H,1-6,10H2 |
| InChIKey | HCMZSBMGIYGBKS-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-piperazin-1-yl-1,3-thiazol-4-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-piperazin-1-yl-1,3-thiazol-4-yl)ethanamine?
The IUPAC name of 2-(2-piperazin-1-yl-1,3-thiazol-4-yl)ethanamine (CID 82278115) is 2-(2-piperazin-1-yl-1,3-thiazol-4-yl)ethanamine.
What is the SMILES notation for 2-(2-piperazin-1-yl-1,3-thiazol-4-yl)ethanamine?
The canonical SMILES for 2-(2-piperazin-1-yl-1,3-thiazol-4-yl)ethanamine is NCCc1csc(N2CCNCC2)n1.
What is the InChIKey of 2-(2-piperazin-1-yl-1,3-thiazol-4-yl)ethanamine?
The InChIKey is HCMZSBMGIYGBKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4S/c10-2-1-8-7-14-9(12-8)13-5-3-11-4-6-13/h7,11H,1-6,10H2.
What are the key properties of 2-(2-piperazin-1-yl-1,3-thiazol-4-yl)ethanamine?
2-(2-piperazin-1-yl-1,3-thiazol-4-yl)ethanamine has a molecular weight of 212.32 g/mol, XLogP of 0.05, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-piperazin-1-yl-1,3-thiazol-4-yl)ethanamine is sourced from PubChem (CID 82278115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).