C13H14ClNO2 — CID 82278454
2-(6-chloro-2-methyl-1H-indol-3-yl)-2-methylpropanoic acid (PubChem CID 82278454) has the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. Its IUPAC name is 2-(6-chloro-2-methyl-1H-indol-3-yl)-2-methylpropanoic acid.
| Compound Name | 2-(6-chloro-2-methyl-1H-indol-3-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 82278454 |
| Molecular Formula | C13H14ClNO2 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-(6-chloro-2-methyl-1H-indol-3-yl)-2-methylpropanoic acid |
| SMILES | Cc1[nH]c2cc(Cl)ccc2c1C(C)(C)C(=O)O |
| InChI | InChI=1S/C13H14ClNO2/c1-7-11(13(2,3)12(16)17)9-5-4-8(14)6-10(9)15-7/h4-6,15H,1-3H3,(H,16,17) |
| InChIKey | DEJNKJAGIBXDEO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |