3-(1,7-dimethylindol-3-yl)-4-methylpentanoic acid

C16H21NO2 — CID 82278709

IUPAC3-(1,7-dimethylindol-3-yl)-4-methylpentanoic acid
SMILESCc1cccc2c(C(CC(=O)O)C(C)C)cn(C)c12
InChIInChI=1S/C16H21NO2/c1-10(2)13(8-15(18)19)14-9-17(4)16-11(3)6-5-7-12(14)16/h5-7,9-10,13H,8H2,1-4H3,(H,18,19)
InChIKeyMZUSIWVFYBBGKS-UHFFFAOYSA-N
MW259.35 g/mol
LogP3.70
Rot. Bonds4

About 3-(1,7-dimethylindol-3-yl)-4-methylpentanoic acid

3-(1,7-dimethylindol-3-yl)-4-methylpentanoic acid (PubChem CID 82278709) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 3-(1,7-dimethylindol-3-yl)-4-methylpentanoic acid.

Molecular Properties

Compound Name3-(1,7-dimethylindol-3-yl)-4-methylpentanoic acid
PubChem CID82278709
Molecular FormulaC16H21NO2
Molecular Weight259.35 g/mol
Exact Mass259.16
IUPAC Name3-(1,7-dimethylindol-3-yl)-4-methylpentanoic acid
SMILESCc1cccc2c(C(CC(=O)O)C(C)C)cn(C)c12
InChIInChI=1S/C16H21NO2/c1-10(2)13(8-15(18)19)14-9-17(4)16-11(3)6-5-7-12(14)16/h5-7,9-10,13H,8H2,1-4H3,(H,18,19)
InChIKeyMZUSIWVFYBBGKS-UHFFFAOYSA-N
XLogP3.70
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.35
LogP ≤ 53.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-(1,7-dimethylindol-3-yl)-4-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-(1,7-dimethylindol-3-yl)butanoic acid
CID 82278698
3-(7-fluoro-1-methylindol-3-yl)-4-methylpentanoic acid
CID 82278711
3-(7-ethyl-1-methylindol-3-yl)butanoic acid
CID 82278699
3-(5-chloro-1-methylindol-3-yl)-4-methylpentanoic acid
CID 133108300
2-(7-ethyl-1-methylindol-3-yl)-3-methylbutan-1-amine
CID 82497776
3-methyl-2-(1,6,7-trimethylindol-3-yl)butan-1-amine
CID 82497738
4-methyl-3-phenylpentanoic acid
CID 3249521
3-hydroxy-3-(1-methylindol-3-yl)propanoic acid
CID 130117642
2-(7-methyl-1-propan-2-ylindol-3-yl)propanoic acid
CID 117197460
2-(7-methoxy-1-methylindol-3-yl)-3-methylbutanoic acid
CID 82666117
2-(1,7-dimethylindazol-3-yl)acetic acid
CID 83908649
3-(1-methylindol-3-yl)-3-(3-methylphenyl)propanoic acid
CID 3542496

Frequently Asked Questions

What is the IUPAC name of 3-(1,7-dimethylindol-3-yl)-4-methylpentanoic acid?
The IUPAC name of 3-(1,7-dimethylindol-3-yl)-4-methylpentanoic acid (CID 82278709) is 3-(1,7-dimethylindol-3-yl)-4-methylpentanoic acid.
What is the SMILES notation for 3-(1,7-dimethylindol-3-yl)-4-methylpentanoic acid?
The canonical SMILES for 3-(1,7-dimethylindol-3-yl)-4-methylpentanoic acid is Cc1cccc2c(C(CC(=O)O)C(C)C)cn(C)c12.
What is the InChIKey of 3-(1,7-dimethylindol-3-yl)-4-methylpentanoic acid?
The InChIKey is MZUSIWVFYBBGKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO2/c1-10(2)13(8-15(18)19)14-9-17(4)16-11(3)6-5-7-12(14)16/h5-7,9-10,13H,8H2,1-4H3,(H,18,19).
What are the key properties of 3-(1,7-dimethylindol-3-yl)-4-methylpentanoic acid?
3-(1,7-dimethylindol-3-yl)-4-methylpentanoic acid has a molecular weight of 259.35 g/mol, XLogP of 3.70, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,7-dimethylindol-3-yl)-4-methylpentanoic acid is sourced from PubChem (CID 82278709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).