2-(6-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)acetic acid

C13H17NO3 — CID 82279784

IUPAC2-(6-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)acetic acid
SMILESCCOc1ccc2c(c1)CCN(CC(=O)O)C2
InChIInChI=1S/C13H17NO3/c1-2-17-12-4-3-11-8-14(9-13(15)16)6-5-10(11)7-12/h3-4,7H,2,5-6,8-9H2,1H3,(H,15,16)
InChIKeyPCSXOOYAOSTIQE-UHFFFAOYSA-N
MW235.28 g/mol
LogP1.53
Rot. Bonds4

About 2-(6-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)acetic acid

2-(6-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)acetic acid (PubChem CID 82279784) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-(6-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)acetic acid.

Molecular Properties

Compound Name2-(6-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)acetic acid
PubChem CID82279784
Molecular FormulaC13H17NO3
Molecular Weight235.28 g/mol
Exact Mass235.12
IUPAC Name2-(6-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)acetic acid
SMILESCCOc1ccc2c(c1)CCN(CC(=O)O)C2
InChIInChI=1S/C13H17NO3/c1-2-17-12-4-3-11-8-14(9-13(15)16)6-5-10(11)7-12/h3-4,7H,2,5-6,8-9H2,1H3,(H,15,16)
InChIKeyPCSXOOYAOSTIQE-UHFFFAOYSA-N
XLogP1.53
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.28
LogP ≤ 51.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(6-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)acetic acid?
The IUPAC name of 2-(6-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)acetic acid (CID 82279784) is 2-(6-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)acetic acid.
What is the SMILES notation for 2-(6-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)acetic acid?
The canonical SMILES for 2-(6-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)acetic acid is CCOc1ccc2c(c1)CCN(CC(=O)O)C2.
What is the InChIKey of 2-(6-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)acetic acid?
The InChIKey is PCSXOOYAOSTIQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c1-2-17-12-4-3-11-8-14(9-13(15)16)6-5-10(11)7-12/h3-4,7H,2,5-6,8-9H2,1H3,(H,15,16).
What are the key properties of 2-(6-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)acetic acid?
2-(6-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)acetic acid has a molecular weight of 235.28 g/mol, XLogP of 1.53, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-ethoxy-3,4-dihydro-1H-isoquinolin-2-yl)acetic acid is sourced from PubChem (CID 82279784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).