C10H9BrFN — CID 82279918
3-bromo-7-fluoro-1,2-dimethylindole (PubChem CID 82279918) has the molecular formula C10H9BrFN and a molecular weight of 242.09 g/mol. Its IUPAC name is 3-bromo-7-fluoro-1,2-dimethylindole.
| Compound Name | 3-bromo-7-fluoro-1,2-dimethylindole |
|---|---|
| PubChem CID | 82279918 |
| Molecular Formula | C10H9BrFN |
| Molecular Weight | 242.09 g/mol |
| Exact Mass | 240.99 |
| IUPAC Name | 3-bromo-7-fluoro-1,2-dimethylindole |
| SMILES | Cc1c(Br)c2cccc(F)c2n1C |
| InChI | InChI=1S/C10H9BrFN/c1-6-9(11)7-4-3-5-8(12)10(7)13(6)2/h3-5H,1-2H3 |
| InChIKey | HVBXEQGYGBUNKU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.09 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |