About N,N-dimethyl-1-(1-methylpyrrol-3-yl)ethane-1,2-diamine
N,N-dimethyl-1-(1-methylpyrrol-3-yl)ethane-1,2-diamine (PubChem CID 82280376) has the molecular formula C9H17N3
and a molecular weight of 167.26 g/mol. Its IUPAC name is N,N-dimethyl-1-(1-methylpyrrol-3-yl)ethane-1,2-diamine.
Analyze N,N-dimethyl-1-(1-methylpyrrol-3-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1-(1-methylpyrrol-3-yl)ethane-1,2-diamine?
The IUPAC name of N,N-dimethyl-1-(1-methylpyrrol-3-yl)ethane-1,2-diamine (CID 82280376) is N,N-dimethyl-1-(1-methylpyrrol-3-yl)ethane-1,2-diamine.
What is the SMILES notation for N,N-dimethyl-1-(1-methylpyrrol-3-yl)ethane-1,2-diamine?
The canonical SMILES for N,N-dimethyl-1-(1-methylpyrrol-3-yl)ethane-1,2-diamine is CN(C)C(CN)c1ccn(C)c1.
What is the InChIKey of N,N-dimethyl-1-(1-methylpyrrol-3-yl)ethane-1,2-diamine?
The InChIKey is AIHIWZIWMCZUBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3/c1-11(2)9(6-10)8-4-5-12(3)7-8/h4-5,7,9H,6,10H2,1-3H3.
What are the key properties of N,N-dimethyl-1-(1-methylpyrrol-3-yl)ethane-1,2-diamine?
N,N-dimethyl-1-(1-methylpyrrol-3-yl)ethane-1,2-diamine has a molecular weight of 167.26 g/mol, XLogP of 0.59, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1-(1-methylpyrrol-3-yl)ethane-1,2-diamine is sourced from PubChem (CID 82280376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).