5-chlorothiophene-2-sulfonyl fluoride

C4H2ClFO2S2 — CID 82282311

IUPAC5-chlorothiophene-2-sulfonyl fluoride
SMILESO=S(=O)(F)c1ccc(Cl)s1
InChIInChI=1S/C4H2ClFO2S2/c5-3-1-2-4(9-3)10(6,7)8/h1-2H
InChIKeyXZQCGAGVTAESGC-UHFFFAOYSA-N
MW200.64 g/mol
LogP2.06
Rot. Bonds1

About 5-chlorothiophene-2-sulfonyl fluoride

5-chlorothiophene-2-sulfonyl fluoride (PubChem CID 82282311) has the molecular formula C4H2ClFO2S2 and a molecular weight of 200.64 g/mol. Its IUPAC name is 5-chlorothiophene-2-sulfonyl fluoride.

Molecular Properties

Compound Name5-chlorothiophene-2-sulfonyl fluoride
PubChem CID82282311
Molecular FormulaC4H2ClFO2S2
Molecular Weight200.64 g/mol
Exact Mass199.92
IUPAC Name5-chlorothiophene-2-sulfonyl fluoride
SMILESO=S(=O)(F)c1ccc(Cl)s1
InChIInChI=1S/C4H2ClFO2S2/c5-3-1-2-4(9-3)10(6,7)8/h1-2H
InChIKeyXZQCGAGVTAESGC-UHFFFAOYSA-N
XLogP2.06
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.64
LogP ≤ 52.06
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 5-chlorothiophene-2-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chlorothiophene-2-sulfonyl fluoride?
The IUPAC name of 5-chlorothiophene-2-sulfonyl fluoride (CID 82282311) is 5-chlorothiophene-2-sulfonyl fluoride.
What is the SMILES notation for 5-chlorothiophene-2-sulfonyl fluoride?
The canonical SMILES for 5-chlorothiophene-2-sulfonyl fluoride is O=S(=O)(F)c1ccc(Cl)s1.
What is the InChIKey of 5-chlorothiophene-2-sulfonyl fluoride?
The InChIKey is XZQCGAGVTAESGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2ClFO2S2/c5-3-1-2-4(9-3)10(6,7)8/h1-2H.
What are the key properties of 5-chlorothiophene-2-sulfonyl fluoride?
5-chlorothiophene-2-sulfonyl fluoride has a molecular weight of 200.64 g/mol, XLogP of 2.06, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chlorothiophene-2-sulfonyl fluoride is sourced from PubChem (CID 82282311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).