C10H11FN4 — CID 82283259
4-(4-fluoro-3-methylphenyl)imidazole-1,2-diamine (PubChem CID 82283259) has the molecular formula C10H11FN4 and a molecular weight of 206.22 g/mol. Its IUPAC name is 4-(4-fluoro-3-methylphenyl)imidazole-1,2-diamine.
| Compound Name | 4-(4-fluoro-3-methylphenyl)imidazole-1,2-diamine |
|---|---|
| PubChem CID | 82283259 |
| Molecular Formula | C10H11FN4 |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 4-(4-fluoro-3-methylphenyl)imidazole-1,2-diamine |
| SMILES | Cc1cc(-c2cn(N)c(N)n2)ccc1F |
| InChI | InChI=1S/C10H11FN4/c1-6-4-7(2-3-8(6)11)9-5-15(13)10(12)14-9/h2-5H,13H2,1H3,(H2,12,14) |
| InChIKey | KQSOWBXEJPMKHP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |