C10H15N3O2 — CID 82283844
2-[butyl(methyl)amino]pyrimidine-5-carboxylic acid (PubChem CID 82283844) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-[butyl(methyl)amino]pyrimidine-5-carboxylic acid.
| Compound Name | 2-[butyl(methyl)amino]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 82283844 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-[butyl(methyl)amino]pyrimidine-5-carboxylic acid |
| SMILES | CCCCN(C)c1ncc(C(=O)O)cn1 |
| InChI | InChI=1S/C10H15N3O2/c1-3-4-5-13(2)10-11-6-8(7-12-10)9(14)15/h6-7H,3-5H2,1-2H3,(H,14,15) |
| InChIKey | JCXHHFGDRKPZOF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |