C10H16N2O3 — CID 82284276
1-(2-methoxyethyl)-3-propan-2-ylpyrazole-5-carboxylic acid (PubChem CID 82284276) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-propan-2-ylpyrazole-5-carboxylic acid.
| Compound Name | 1-(2-methoxyethyl)-3-propan-2-ylpyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82284276 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1-(2-methoxyethyl)-3-propan-2-ylpyrazole-5-carboxylic acid |
| SMILES | COCCn1nc(C(C)C)cc1C(=O)O |
| InChI | InChI=1S/C10H16N2O3/c1-7(2)8-6-9(10(13)14)12(11-8)4-5-15-3/h6-7H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | GLHICCLVXGKORZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |