C13H17N3 — CID 82284738
5-(2,3,5,6-tetramethylphenyl)-1H-imidazol-2-amine (PubChem CID 82284738) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 5-(2,3,5,6-tetramethylphenyl)-1H-imidazol-2-amine.
| Compound Name | 5-(2,3,5,6-tetramethylphenyl)-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 82284738 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 5-(2,3,5,6-tetramethylphenyl)-1H-imidazol-2-amine |
| SMILES | Cc1cc(C)c(C)c(-c2cnc(N)[nH]2)c1C |
| InChI | InChI=1S/C13H17N3/c1-7-5-8(2)10(4)12(9(7)3)11-6-15-13(14)16-11/h5-6H,1-4H3,(H3,14,15,16) |
| InChIKey | OUKDSKXGILFMKM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |