About 5-(4-ethylphenyl)-3,3-dimethylpiperidine
5-(4-ethylphenyl)-3,3-dimethylpiperidine (PubChem CID 82285256) has the molecular formula C15H23N
and a molecular weight of 217.36 g/mol. Its IUPAC name is 5-(4-ethylphenyl)-3,3-dimethylpiperidine.
Molecular Properties
| Compound Name | 5-(4-ethylphenyl)-3,3-dimethylpiperidine |
| PubChem CID | 82285256 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 5-(4-ethylphenyl)-3,3-dimethylpiperidine |
| SMILES | CCc1ccc(C2CNCC(C)(C)C2)cc1 |
| InChI | InChI=1S/C15H23N/c1-4-12-5-7-13(8-6-12)14-9-15(2,3)11-16-10-14/h5-8,14,16H,4,9-11H2,1-3H3 |
| InChIKey | DDOTVNIEEROAFU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(4-ethylphenyl)-3,3-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-ethylphenyl)-3,3-dimethylpiperidine?
The IUPAC name of 5-(4-ethylphenyl)-3,3-dimethylpiperidine (CID 82285256) is 5-(4-ethylphenyl)-3,3-dimethylpiperidine.
What is the SMILES notation for 5-(4-ethylphenyl)-3,3-dimethylpiperidine?
The canonical SMILES for 5-(4-ethylphenyl)-3,3-dimethylpiperidine is CCc1ccc(C2CNCC(C)(C)C2)cc1.
What is the InChIKey of 5-(4-ethylphenyl)-3,3-dimethylpiperidine?
The InChIKey is DDOTVNIEEROAFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N/c1-4-12-5-7-13(8-6-12)14-9-15(2,3)11-16-10-14/h5-8,14,16H,4,9-11H2,1-3H3.
What are the key properties of 5-(4-ethylphenyl)-3,3-dimethylpiperidine?
5-(4-ethylphenyl)-3,3-dimethylpiperidine has a molecular weight of 217.36 g/mol, XLogP of 3.35, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-ethylphenyl)-3,3-dimethylpiperidine is sourced from PubChem (CID 82285256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).