C11H17N7 — CID 822855
N-tert-butyl-6-(3,5-dimethylpyrazol-1-yl)-1,2,4,5-tetrazin-3-amine (PubChem CID 822855) has the molecular formula C11H17N7 and a molecular weight of 247.31 g/mol. Its IUPAC name is N-tert-butyl-6-(3,5-dimethylpyrazol-1-yl)-1,2,4,5-tetrazin-3-amine.
| Compound Name | N-tert-butyl-6-(3,5-dimethylpyrazol-1-yl)-1,2,4,5-tetrazin-3-amine |
|---|---|
| PubChem CID | 822855 |
| Molecular Formula | C11H17N7 |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | N-tert-butyl-6-(3,5-dimethylpyrazol-1-yl)-1,2,4,5-tetrazin-3-amine |
| SMILES | Cc1cc(C)n(-c2nnc(NC(C)(C)C)nn2)n1 |
| InChI | InChI=1S/C11H17N7/c1-7-6-8(2)18(17-7)10-15-13-9(14-16-10)12-11(3,4)5/h6H,1-5H3,(H,12,13,14) |
| InChIKey | OGUKPYCANCYATN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|